text
listlengths 3
3
|
|---|
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It belongs to the diabetes treatment class of molecules.",
"role": "user"
},
{
"content": "CC(C)(C(=O)O)C1CCC(Oc2nc3nc(-c4ccc(N5CCC(O)C5)cc4)c(Cl)cc3[nH]2)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is anti inflammatory.",
"role": "user"
},
{
"content": "CCC#CCOc1nc(C(F)(F)F)ccc1C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and tangier disease. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC)OC(=O)CCCCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a pi3 kinase inhibitor.",
"role": "user"
},
{
"content": "CC(Nc1nc(Cl)ncc1N)c1nc2ccc(F)cc2n1-c1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a energy storage, energy source, membrane stabilizer, inflammatory that has an effect on lipotoxicity and impacts metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(CO)COC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCCCCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is both a anti allergic and a anti allergic agent.",
"role": "user"
},
{
"content": "CNc1ccc2c(OC)c(OC(C)=O)c(=O)[nH]c2c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a inflammatory and energy source, affecting cancer, and impacting pancreatitis, cardiovascular disease, and atherosclerosis. The molecule is a energy storage and a membrane stabilizer, belonging to the thyroxine treatment class of molecules. The molecule is a nutrient and a fat storage, impacting both obesity and metabolic syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a nutrient.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC(O)C(O)CCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and tangier disease. The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts diabetic heart disease, aging, and non-alcoholic fatty liver disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation and a stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease, tangier disease, and barth syndrome. The molecule is a proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase, apoptosis that impacts diabetic heart disease and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a wnt pathway inhibitor.",
"role": "user"
},
{
"content": "CC(C)(C)CC(=O)Nc1cncc(-c2cnc3n[nH]c(-c4cc5c(-c6cccs6)cncc5[nH]4)c3c2)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure and a cholesterol translocation that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation that impacts barth syndrome and diabetic heart disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a rock inhibitor. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CC(C)(C)c1ncc2cc(C(C)(C)C)[nH]c2n1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is both a anti histamine and a histamine receptor antagonist.",
"role": "user"
},
{
"content": "CN(C)CCC=C1c2ccccc2CC(=O)c2sc(Br)cc21.Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a stabilizing mitochondrial structure that impacts tangier disease, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is both a prmt5 inhibitor and a cancer treatment.",
"role": "user"
},
{
"content": "Cc1ccc2c(c1)CC(C(O)CN)N(C(=O)OC(C)(C)C)C2",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It has an effect on stomach cancer, and impacts alzheimer's disease, breast cancer, and seizure. It has an effect on colorectal cancer, and impacts cardiovascular disease, parkinson's disease, and diabetes mellitus.",
"role": "user"
},
{
"content": "CCCCCC=CCC(O)C(O)CCCCCCCC(=O)OCC(COP(=O)(O)OC1C(O)C(O)C(O)C(O)C1O)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase, impacting both barth syndrome and non-alcoholic fatty liver disease. The molecule is a apoptosis, proton trap for oxidative phosphorylation, energy source, energy storage that impacts tangier disease. The molecule is a surfactant, emulsifier, nutritional supplement, membrane stabilizer. The molecule is a stabilizing mitochondrial structure and a food additive, which impacts both aging and diabetic heart disease, and is characterized as smooth. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a tyrosine kinase inhibitor and belongs to the anti cancer agent class of molecules, with the characteristic of being cancer treatment.",
"role": "user"
},
{
"content": "COc1ccc(C(O)CNc2cc[nH]c(=O)c2-c2nc3c(C)cc(-n4cnc(C)c4)cc3[nH]2)cc1Br",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a migraine treatment.",
"role": "user"
},
{
"content": "CN(C)CCn1ncc2cccc(-n3cnnc3)c21.Cl.Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a protein kinase inhibitor.",
"role": "user"
},
{
"content": "O=C(Nc1ccc(Oc2ccncc2)cc1)Nc1cc(N2CCOCC2)cc(C(F)(F)F)c1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts diabetic heart disease, aging, and barth syndrome. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation and a apoptosis that impacts tangier disease, diabetic heart disease, and barth syndrome. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts aging and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It impacts cancer treatment.",
"role": "user"
},
{
"content": "CC(=O)c1c(C)c2cnc(Nc3ccc(N4CCN(CCCCCC(=O)NC(C(=O)N5CC(O)CC5C(=O)NCc5ccc(-c6scnc6C)cc5)C(C)(C)C)CC4)cn3)nc2n(C2CCCC2)c1=O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a surfactant, a energy source, and a stabilizing mitochondrial structure, and it impacts barth syndrome. The molecule is a proton trap for oxidative phosphorylation, nutritional supplement, food additive, membrane stabilizer, and smooth. The molecule is a stabilizing cytochrome oxidase and a apoptosis, impacting both aging and diabetic heart disease. The molecule is a cholesterol translocation, emulsifier, energy storage that impacts tangier disease and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CC=CCCCCCC)OC(=O)CCCCCCCC=CC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts diabetic heart disease, tangier disease, and aging. The molecule is a apoptosis, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease and barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCC=CCC)OC(=O)CCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure, apoptosis, stabilizing cytochrome oxidase that impacts aging and tangier disease. The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a apoptosis, cholesterol translocation, stabilizing mitochondrial structure that impacts barth syndrome and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient that impacts both metabolic syndrome and atherosclerosis. The molecule is a fat storage and thyroxine treatment, impacting both pancreatitis and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts tangier disease, aging, and diabetic heart disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a fat storage that impacts both pancreatitis and metabolic syndrome. The molecule is a nutrient and belongs to the thyroxine treatment class of molecules, impacting both cardiovascular disease and atherosclerosis. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a fat storage that impacts both cardiovascular disease and thyroxine treatment. The molecule is a nutrient that impacts atherosclerosis, metabolic syndrome, and pancreatitis.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a pi3k inhibitor.",
"role": "user"
},
{
"content": "CC(N)c1nc2ncccn2c1-c1ccccn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a stabilizing cytochrome oxidase and a apoptosis that impacts non-alcoholic fatty liver disease, diabetic heart disease, and tangier disease. The molecule is a cholesterol translocation, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation that impacts barth syndrome and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCCCCCCC)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a thyroxine treatment that impacts both pancreatitis and cardiovascular disease. The molecule is a nutrient and a fat storage, impacting both metabolic syndrome and atherosclerosis. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a apoptosis, stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts tangier disease. The molecule is a cholesterol translocation that impacts diabetic heart disease, aging, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a cholesterol translocation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and aging. The molecule is a stabilizing cytochrome oxidase and a proton trap for oxidative phosphorylation that impacts diabetic heart disease, barth syndrome, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a cholesterol translocation and a apoptosis that impacts diabetic heart disease, aging, and tangier disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts barth syndrome and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a inflammatory, nutrient, fat storage that impacts atherosclerosis, cardiovascular disease, and pancreatitis. The molecule is a membrane stabilizer, a energy source, and a energy storage. It impacts obesity, metabolic syndrome, cancer, and thyroxine treatment.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts aging and diabetic heart disease. The molecule is a apoptosis and a cholesterol translocation that impacts barth syndrome, tangier disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a nutrient.",
"role": "user"
},
{
"content": "CCC(C)CCCC(C)CCCC(C)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, barth syndrome, tangier disease, and aging. The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis, stabilizing cytochrome oxidase that impacts non-alcoholic fatty liver disease. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a platelet aggregation inhibitor. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "O=C(O)Cc1ccccc1CCCS(=O)(=O)c1ccc(Cl)cc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a nutrient that impacts parkinson's disease, non-alcoholic fatty liver disease, diabetes mellitus type 2, and alzheimer's disease.",
"role": "user"
},
{
"content": "CCC=CCC=CC=CC(O)CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure and a proton trap for oxidative phosphorylation that impacts tangier disease, diabetic heart disease, and aging. The molecule is a apoptosis, stabilizing cytochrome oxidase, cholesterol translocation that impacts non-alcoholic fatty liver disease and barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts barth syndrome and diabetic heart disease. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a obesity treatment, a anti diabetic, and a diabetes treatment.",
"role": "user"
},
{
"content": "Cc1ccc(NC(=O)c2cc(Oc3cc(F)ccc3S(C)(=O)=O)c3c(c2)OC(C)(CO)C3)nc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a membrane stabilizer, nutrient, energy storage that belongs to the thyroxine treatment class of molecules and impacts both atherosclerosis and metabolic syndrome. It has an effect on cancer, impacting both cardiovascular disease and pancreatitis. The molecule is a inflammatory, a fat storage, and a energy source, and it impacts obesity.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a nutrient, emulsifier, energy storage, surfactant, membrane stabilizer, energy source.",
"role": "user"
},
{
"content": "CC(=O)OC1C(C)OC(OC(=O)C23CCC(C)(C)CC2C2=CCC4C5(C)CCC(OC6OC(C(=O)O)C(O)C(OC7OC(C)C(O)C(O)C7O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(C=O)C5CCC4(C)C2(C)CC3O)C(OC2OC(C)C(OC3OCC(O)C(O)C3O)C(O)C2O)C1OC1OC(CO)C(O)C(O)C1O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient that impacts alzheimer's disease, diabetes mellitus type 2, parkinson's disease, and non-alcoholic fatty liver disease.",
"role": "user"
},
{
"content": "CCCCCC=CC=CC(=O)CCCCCCCC(=O)OCC(COP(=O)(O)OCCN)OC=CCCCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a apoptosis and a cholesterol translocation that impacts tangier disease, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, stabilizing cytochrome oxidase that impacts aging and barth syndrome. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a kinase inhibitor.",
"role": "user"
},
{
"content": "CC(C)Cc1ncc(-c2cc(-c3ccccc3CNC(=O)OC(C)(C)C)nc(S(C)(=O)=O)n2)s1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: It belongs to the liquid crystal class of molecules.",
"role": "user"
},
{
"content": "CCCC1CCCC2C1CCC1C3CCC(C#N)(CC)CC3CCC21",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Can you create a molecule that matches the given characteristics? The molecule is a nutrient.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(N)C(=O)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a fat storage, membrane stabilizer, energy storage that impacts pancreatitis, obesity, and atherosclerosis. The molecule is a inflammatory and nutrient, and it impacts metabolic syndrome. The molecule is a energy source and belongs to the thyroxine treatment class of molecules, impacting both cardiovascular disease and cancer.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, cholesterol translocation that impacts tangier disease and diabetic heart disease. The molecule is a apoptosis and a proton trap for oxidative phosphorylation that impacts barth syndrome, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC)OC(=O)CCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a cholesterol translocation and a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a proton trap for oxidative phosphorylation, apoptosis, stabilizing mitochondrial structure that impacts tangier disease and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a cholesterol translocation that impacts tangier disease, barth syndrome, diabetic heart disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing cytochrome oxidase, stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts aging. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a pain treatment.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1CC2C=C(c3ccc(Cl)nc3)CC2C1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: It impacts insulin resistance, pick's disease, and diabetes mellitus type 2. The molecule is a nutrient that impacts diabetes mellitus type 1, atherosclerosis, and cardiovascular disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CC=CCC1C(O)CC(O)C1C=CC(O)CCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure and a apoptosis that impacts aging, non-alcoholic fatty liver disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, cholesterol translocation, stabilizing cytochrome oxidase that impacts barth syndrome and diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCC)OC(=O)CCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a membrane stabilizer, fat storage, energy source, nutrient that impacts thyroxine treatment and pancreatitis. The molecule is a inflammatory that impacts both cardiovascular disease and obesity. The molecule is a energy storage that affects cancer by impacting both atherosclerosis and metabolic syndrome.",
"role": "user"
},
{
"content": "CC(C)CCCCCCCCCCCCCCCCCCC(=O)OCC(COC(=O)CCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a membrane stabilizer, fat storage, inflammatory that impacts obesity, atherosclerosis, and cardiovascular disease. The molecule is a nutrient and energy source, and it impacts pancreatitis. The molecule is a energy storage that affects cancer by impacting both thyroxine treatment and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a inflammatory, fat storage, thyroxine treatment, energy storage that impacts pancreatitis and atherosclerosis. The molecule is a energy source that impacts both cardiovascular disease and metabolic syndrome. The molecule is a nutrient and a membrane stabilizer, with effects on cancer and impacts on obesity. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C)COC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: The molecule is a nutrient that impacts both metabolic syndrome and cardiovascular disease. The molecule is a fat storage and belongs to the thyroxine treatment class of molecules, impacting both pancreatitis and atherosclerosis.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COC(=O)CCCCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): It impacts cancer treatment.",
"role": "user"
},
{
"content": "O=C(O)Nc1ccc(Oc2ccnc3[nH]c(=O)[nH]c23)c2ccccc12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a waste product and belongs to the drug metabolite class of molecules.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCC=CCC=CCC=CCC=CCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It belongs to the serotonin antagonist class of molecules.",
"role": "user"
},
{
"content": "CCN1CCN(c2nc(-c3ccc(OCC(C)(C)O)cc3)cc3ccccc23)CC1.Cl.Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a energy source, inflammatory, nutrient, energy storage that impacts cardiovascular disease and obesity. The molecule is a fat storage that impacts both cancer and pancreatitis. The molecule is a membrane stabilizer and a thyroxine treatment, impacting both metabolic syndrome and atherosclerosis. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a magl inhibitor.",
"role": "user"
},
{
"content": "CC1C(OCc2c(F)cccc2C(F)(F)F)CN1OC(=O)C(F)(F)F",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, proton trap for oxidative phosphorylation, apoptosis that impacts barth syndrome and diabetic heart disease. The molecule is a stabilizing cytochrome oxidase and a cholesterol translocation that impacts non-alcoholic fatty liver disease, aging, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC(C)CC)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts cervical cancer, ulcerative colitis, atherosclerosis, and breast cancer.",
"role": "user"
},
{
"content": "CCCCCC(=O)C=CC=CCC=CCC=CCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCc1oc(CCCCC)c(C)c1C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a dyslipidemia treatment and is ppar modulator. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "O=C(O)COc1ccc(SCC=C(c2ccccc2C(F)(F)F)c2ccccc2C(F)(F)F)cc1I",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: The molecule is a cholesterol translocation and a proton trap for oxidative phosphorylation, it impacts non-alcoholic fatty liver disease, and is smooth. The molecule is a food additive, surfactant, membrane stabilizer that impacts tangier disease and barth syndrome. The molecule is a stabilizing cytochrome oxidase, a emulsifier, and a energy storage, and it impacts aging. The molecule is a stabilizing mitochondrial structure, energy source, nutritional supplement, apoptosis that impacts diabetic heart disease.",
"role": "user"
},
{
"content": "CCCCCCC=CC=CCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a nutrient that affects both cervical cancer and breast cancer, and also impacts ulcerative colitis and atherosclerosis. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCC=CCC=CC=CC(O)CCCCCCCC(=O)OCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule based on this description: It belongs to the alzheimer's treatment class of molecules.",
"role": "user"
},
{
"content": "O=C(C1CC1)N1CCC(Oc2ccccc2-c2ccncn2)CC1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Build a molecule that meets the requirement: The molecule is a protease inhibitor.",
"role": "user"
},
{
"content": "COc1cccc2[nH]c(C(=O)NC(CC(C)C)C(=O)NC(CC3CCNC3=O)C(O)S(=O)(=O)O)cc12",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a nutrient that impacts both pancreatitis and cardiovascular disease. The molecule is a fat storage and thyroxine treatment, impacting both atherosclerosis and metabolic syndrome.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a stabilizing mitochondrial structure, apoptosis, cholesterol translocation, proton trap for oxidative phosphorylation that impacts tangier disease. The molecule is a stabilizing cytochrome oxidase that impacts barth syndrome, diabetic heart disease, non-alcoholic fatty liver disease, and aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCC=CCC=CCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a nutrient that impacts both atherosclerosis and diabetes mellitus type 2. It impacts diabetes mellitus type 1, insulin resistance, pick's disease, and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCC=CCCCCCCCCC=CC(O)C(COP(=O)([O-])OCC[N+](C)(C)C)NC(=O)CCCCCCCCCCCC=CCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I give you a description of a molecule, and you need to return one molecule in SMILES that meets the description. The description: It belongs to both the s1p1 agonist and treatment of disorder classes of molecules.",
"role": "user"
},
{
"content": "CC(=O)CCc1cccc(-c2noc(-c3ccc(OC(C)C)c(C#N)c3)n2)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a 11βhsd1 inhibitor.",
"role": "user"
},
{
"content": "C=CC=CC(=CC)C(=CC)N1N(C2C3CC4CC(C3)CC2C4)C(=O)C1(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, apoptosis that impacts tangier disease and aging. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase that impacts diabetic heart disease, non-alcoholic fatty liver disease, and barth syndrome.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a anti viral, anti inflammatory, and anti cancer compound.",
"role": "user"
},
{
"content": "CC(C)(C)CCCCNC(=O)COCc1ccccc1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Give me a molecule that satisfies the conditions outlined in the description: The molecule is a fgfr4 inhibitor and belongs to the inflammatory treatment class of molecules.",
"role": "user"
},
{
"content": "CCOC(=O)C=Cc1c(Cl)c(OC)cc(OC)c1Cl",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a proton trap for oxidative phosphorylation and a cholesterol translocation that impacts diabetic heart disease, tangier disease, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, apoptosis that impacts barth syndrome and aging.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCC(C)C)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a kinase inhibitor. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CNc1cc(Oc2ccc3c(C(=O)Nc4cc(C(C)(C)C)nn4-c4cccc(CN5CCOCC5)c4)cccc3c2)ncn1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? It belongs to the anti viral class of molecules.",
"role": "user"
},
{
"content": "CC1(OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)C(COC(=O)c2ccccc2)OC1N1c2nc(N)[nH]c(=O)c2SC1(C)O",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: It belongs to the organic light-emitting device class of molecules.",
"role": "user"
},
{
"content": "C1=C2Sc3ccc(N(c4ccccc4)c4cccc5ccccc45)cc3C2CC(N(c2ccccc2)c2cccc3ccccc23)=C1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Could you please return a molecule that adheres to this description? The molecule is a stabilizing mitochondrial structure that impacts diabetic heart disease, tangier disease, non-alcoholic fatty liver disease, and barth syndrome. The molecule is a stabilizing cytochrome oxidase, apoptosis, proton trap for oxidative phosphorylation, cholesterol translocation that impacts aging.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OC(COC(=O)CCCC=CCC=CCC=CCC=CCC=CCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: When heated to decomposition it emits acrid smoke and irritating fumes.",
"role": "user"
},
{
"content": "CC12C(=O)OC(=O)C1(C)C1CCC2O1",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Based on the given information, generate a molecule that meets the desired specifications: It impacts diabetes mellitus type 2, pick's disease, and diabetes mellitus type 1. The molecule is a nutrient that impacts atherosclerosis, insulin resistance, and cardiovascular disease.",
"role": "user"
},
{
"content": "CCCCCC=CCC(O)C=CC=CCC=CCCCC(=O)NC(COP(=O)([O-])OCC[N+](C)(C)C)C(O)C=CCCCCCCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "I need a molecule that meets the following conditions: The molecule is a cholesterol translocation, proton trap for oxidative phosphorylation, stabilizing mitochondrial structure that impacts aging and tangier disease. The molecule is a apoptosis and a stabilizing cytochrome oxidase that impacts barth syndrome, non-alcoholic fatty liver disease, and diabetic heart disease. Please represent the molecule in SMILES.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCCCCCCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCC=CCCCCCC)OC(=O)CCCCCCCCCC=CCC=CCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Suppose there is a molecule that meets the following description: The molecule is a cholesterol translocation and a apoptosis that impacts barth syndrome, non-alcoholic fatty liver disease, and tangier disease. The molecule is a proton trap for oxidative phosphorylation, stabilizing mitochondrial structure, stabilizing cytochrome oxidase that impacts diabetic heart disease and aging. Please write the SMILES representation of it.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCCCCC(=O)OC(COC(=O)CCCCCCCC=CCC=CCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Generate a molecule that fulfills the requirement: The molecule is a stabilizing mitochondrial structure, stabilizing cytochrome oxidase, proton trap for oxidative phosphorylation that impacts barth syndrome and aging. The molecule is a apoptosis and a cholesterol translocation that impacts diabetic heart disease, non-alcoholic fatty liver disease, and tangier disease.",
"role": "user"
},
{
"content": "CCCCCCCCCCCCCCCCCC(=O)OC(COC(=O)CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCCCCCCCCC(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Conceptualize a molecule that meets the specified attribute(s): The molecule is a emulsifier that impacts tangier disease, aging, and non-alcoholic fatty liver disease. The molecule is a stabilizing mitochondrial structure, cholesterol translocation, proton trap for oxidative phosphorylation, surfactant that impacts barth syndrome. The molecule is a membrane stabilizer, a food additive, and a energy storage, and it impacts diabetic heart disease. The molecule is a nutritional supplement, apoptosis, energy source, stabilizing cytochrome oxidase, and smooth.",
"role": "user"
},
{
"content": "CCC(C)CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCCCCCCC(C)C)OC(=O)CCCCCCCCC(C)CC",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "The molecule is a nutrient that affects breast cancer by impacting atherosclerosis, cervical cancer, and ulcerative colitis. Use the above information to create a molecule.",
"role": "user"
},
{
"content": "CCCCCC=CCC=CCC=CCCCCCCC(=O)OC(COC(=O)CCCCC(=O)CC1C(O)CC(O)C1C=CC(O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C",
"role": "assistant"
}
] |
[
{
"content": "You are a chemist. Now you are given a description of a molecule. Please generate a molecule that meets the description.",
"role": "system"
},
{
"content": "Come up with a molecule based on the description: The molecule is a membrane stabilizer, a nutritional supplement, and a energy source, and it impacts tangier disease. The molecule is a food additive, a energy storage, and a emulsifier, it impacts aging and is smooth. The molecule is a stabilizing mitochondrial structure and a stabilizing cytochrome oxidase, impacting both non-alcoholic fatty liver disease and diabetic heart disease. The molecule is a surfactant, proton trap for oxidative phosphorylation, cholesterol translocation, apoptosis that impacts barth syndrome.",
"role": "user"
},
{
"content": "CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)OC(COC(=O)CCCCCCCC=CCCCCCC)COP(=O)(O)OCC(O)COP(=O)(O)OCC(COC(=O)CCC=CCC=CCC=CCC=CCC=CCCCCC)OC(=O)CCCCCCCCCCCCCCCCC",
"role": "assistant"
}
] |