id
int64 0
129k
| molecules
dict | messages
listlengths 3
3
| ground_truth
stringclasses 1
value |
---|---|---|---|
100 | {
"selfies": [
"[C][C][C][=Branch1][C][=O][O][C][C][Branch1][C][N][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCC(=O)OCC(N)C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCC(=O)Cl.NC(CO)C(=O)O",
"role": "assistant"
}
] | |
101 | {
"selfies": [
"[C][C][C][N][Branch2][Ring1][Ring1][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][C][Branch1][C][C][N][Ring1][P]"
],
"smiles": [
"CC1CN(c2ccc(C(C)(C)C)cc2)CC(C)N1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)c1ccc(Br)cc1.CC1CNCC(C)N1",
"role": "assistant"
}
] | |
102 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][C][Branch2][Branch1][=Branch1][N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][O][C][C][Ring1][=Branch1][C][=Branch1][C][=O][N][Branch2][Ring1][Ring1][C][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][O][Ring1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring1][Ring2][C][Ring2][Ring2][C]"
],
"smiles": [
"CC(C)(C)OC(=O)N1CCC(Nc2ccc3c(c2)OCC32C(=O)N(Cc3ccc(C(F)(F)F)o3)c3ccccc32)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)OC(=O)N1CCC(N)C1.O=C1N(Cc2ccc(C(F)(F)F)o2)c2ccccc2C12COc1cc(Br)ccc12 .",
"role": "assistant"
}
] | |
103 | {
"selfies": [
"[C][C][N][=C][Branch1][P][N][C][=Branch1][C][=O][C][C][=C][NH1][C][=Branch1][C][=O][C][=Ring1][#Branch1][S][C][=Ring1][#C][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"Cc1nc(NC(=O)c2cc[nH]c(=O)c2)sc1C(=O)NCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1cc(C(=O)Nc2nc(C)c(C(=O)NCc3ccccc3)s2)ccn1",
"role": "assistant"
}
] | |
104 | {
"selfies": [
"[C][C][C][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][=C][NH1][C][=Ring1][#Branch2][C][=C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][Ring1][=N]"
],
"smiles": [
"Cc1c(CCC(=O)O)c[nH]c1C=C1C(=O)Nc2ccc(C(=O)O)cc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "Cc1c(CCC(=O)O)c[nH]c1C=O.O=C1Cc2cc(C(=O)O)ccc2N1",
"role": "assistant"
}
] | |
105 | {
"selfies": [
"[C][C][N][C][Branch2][Ring1][=Branch2][N][C][=N][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][S][Ring1][=N][=N][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][=C][Ring1][=Branch2][Ring2][Ring1][#Branch2]"
],
"smiles": [
"CCn1c(Nc2nc3ccc(C(F)(F)F)cc3s2)nc2cc(C(=O)O)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCn1c(Nc2nc3ccc(C(F)(F)F)cc3s2)nc2cc(C(=O)OC)ccc21 .",
"role": "assistant"
}
] | |
106 | {
"selfies": [
"[C][C][Branch1][C][O][C][=C][C][=C][C][Branch1][C][I][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(O)c1cccc(I)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CC(=O)c1cccc(I)c1",
"role": "assistant"
}
] | |
107 | {
"selfies": [
"[C][C][=C][C][Branch2][Ring1][=N][C][=Branch1][C][=O][N][C][Branch1][P][C][=N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][NH1][Ring1][#Branch2][C][C][Ring1][=N][=C][C][=C][Ring2][Ring1][=Branch1][C][=Branch1][C][=O][N][C][C][C][C][Ring1][Branch1]"
],
"smiles": [
"Cc1cc(C(=O)NC2(c3nc4cc(Cl)ccc4[nH]3)CC2)ccc1C(=O)N1CCCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1cc(C(=O)O)ccc1C(=O)N1CCCC1.NC1(c2nc3cc(Cl)ccc3[nH]2)CC1",
"role": "assistant"
}
] | |
108 | {
"selfies": [
"[C][N][Branch1][C][C][C][=C][C][Branch1][#Branch2][N][S][Branch1][C][C][=Branch1][C][=O][=O][=C][C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"CN(C)c1cc(NS(C)(=O)=O)cc(B2OC(C)(C)C(C)(C)O2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CN(C)c1cc(N)cc(B2OC(C)(C)C(C)(C)O2)c1.CS(=O)(=O)Cl",
"role": "assistant"
}
] | |
109 | {
"selfies": [
"[C][C][=N][C][Branch1][C][N][=N][C][Branch1][S][N][C][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][C][Ring1][=Branch2][=C][Ring1][S][C][#C][C][=C][C][=C][Branch1][C][N][N][=C][Ring1][#Branch1]"
],
"smiles": [
"Cc1nc(N)nc(N2CCC(C(=O)O)CC2)c1C#Cc1ccc(N)nc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)C1CCN(c2nc(N)nc(C)c2C#Cc2ccc(N)nc2)CC1",
"role": "assistant"
}
] | |
110 | {
"selfies": [
"[C][N][Branch1][C][C][C][=C][C][Branch1][C][F][=C][C][Branch2][Ring2][C][C][N][C][=C][C][=C][Branch1][=C][C][=Branch1][C][=O][N][S][Branch1][C][C][=Branch1][C][=O][=O][C][=C][Ring1][=N][C][C][Ring1][P][Branch1][C][C][C][=C][Ring2][Ring1][#Branch2]"
],
"smiles": [
"CN(C)c1cc(F)cc(C2Nc3ccc(C(=O)NS(C)(=O)=O)cc3CC2(C)C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CN(C)c1cc(F)cc(C2Nc3ccc(C(=O)O)cc3CC2(C)C)c1.CS(N)(=O)=O",
"role": "assistant"
}
] | |
111 | {
"selfies": [
"[O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][N][Ring1][Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=Cc1cccc2c1ccn2S(=O)(=O)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "O=Cc1cccc2[nH]ccc12.O=S(=O)(Cl)c1ccccc1",
"role": "assistant"
}
] | |
112 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C][=C][C][=C][C][Branch2][Ring1][Ring2][C][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][Ring2][C][C][Cl][=C][Ring1][=Branch2][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)OCc1cccc(CNC(=O)c2cccc(CCCl)c2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CC(C)(C)[Si](C)(C)OCc1cccc(CN)c1.O=C(Cl)c1cccc(CCCl)c1 .",
"role": "assistant"
}
] | |
113 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][C][C][N][C][=Branch1][C][=O][C][=C][C][=C][NH1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][Ring1][Branch2][=C][Ring1][N]"
],
"smiles": [
"CC(C)(C)OC(=O)NCCNC(=O)c1ccc2[nH]c(C(=O)O)cc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)c1cc2cc(C(=O)NCCNC(=O)OC(C)(C)C)ccc2[nH]1",
"role": "assistant"
}
] | |
114 | {
"selfies": [
"[C][C][Branch1][C][O][C][Branch1][C][C][Branch1][C][C][N][C][=Branch1][C][=O][C][=C][NH1][C][=N][C][=C][Branch2][Ring1][Ring2][C][=N][N][Branch1][C][C][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][O][Ring1][#Branch1][N][=C][Ring2][Ring1][Ring2][Ring1][P]"
],
"smiles": [
"CC(O)C(C)(C)NC(=O)c1c[nH]c2ncc(-c3nn(C)c4cc(Cl)ccc34)nc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CC(O)C(C)(C)N.Cn1nc(-c2cnc3[nH]cc(C(=O)O)c3n2)c2ccc(Cl)cc21",
"role": "assistant"
}
] | |
115 | {
"selfies": [
"[C][C][=N][C][Branch1][C][Cl][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][=Branch1][N][C][C][C][O][=C][Ring1][#C][C]"
],
"smiles": [
"Cc1nc(Cl)c([N+](=O)[O-])c(NCCCO)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "Cc1nc(Cl)c([N+](=O)[O-])c(Cl)c1C.NCCCO",
"role": "assistant"
}
] | |
116 | {
"selfies": [
"[N][C][=Branch1][C][=O][C][Branch2][Ring1][Branch1][N][C][=Branch1][C][=O][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][C][C][Ring1][#C]"
],
"smiles": [
"NC(=O)C1(NC(=O)c2cccc([N+](=O)[O-])c2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: N.O=C(NC1(C(=O)O)CC1)c1cccc([N+](=O)[O-])c1 .",
"role": "assistant"
}
] | |
117 | {
"selfies": [
"[C][C][=C][C][NH1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][=Ring1][Branch2][C][Branch1][C][C][=C][Ring1][=N][O][C][=C][C][=C][Branch1][C][O][C][Branch1][S][C][Branch1][C][O][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][=C][Ring1][S]"
],
"smiles": [
"Cc1cc2[nH]c(C(=O)O)cc2c(C)c1Oc1ccc(O)c(C(O)c2ccc(F)cc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CCOC(=O)c1cc2c(C)c(Oc3ccc(O)c(C(O)c4ccc(F)cc4)c3)c(C)cc2[nH]1 .",
"role": "assistant"
}
] | |
118 | {
"selfies": [
"[C][C][=Branch1][C][=O][O][C][=C][C][=C][Branch2][Ring1][#Branch1][C][C][=C][Branch1][C][C][C][=Branch1][C][=O][C][Branch1][C][C][=C][Branch1][C][C][C][Ring1][#Branch2][=O][C][=C][Ring2][Ring1][C][C][=Branch1][C][=O][N][C][=C][C][=C][N][=C][Ring1][=Branch1][Cl]"
],
"smiles": [
"CC(=O)Oc1ccc(CC2=C(C)C(=O)C(C)=C(C)C2=O)cc1C(=O)Nc1cccnc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CC(=O)Oc1ccc(CC2=C(C)C(=O)C(C)=C(C)C2=O)cc1C(=O)O.Nc1cccnc1Cl",
"role": "assistant"
}
] | |
119 | {
"selfies": [
"[C][C][C][C][C][C][Branch1][S][C][N][C][=Branch1][C][=O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][O][Ring1][Branch1]"
],
"smiles": [
"CCCCCC(CNC(=O)Oc1ccccc1)c1cccc2c1OCO2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCCCCC(CN)c1cccc2c1OCO2.O=C(Cl)Oc1ccccc1",
"role": "assistant"
}
] | |
120 | {
"selfies": [
"[C][C][C][=N][C][=C][Branch1][Branch2][C][=N][N][Ring1][Branch1][C][C][C][Branch1][#Branch2][N][C][C][C][O][C][C][Ring1][=Branch1][=C][Ring2][Ring1][C][C][N][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][O]"
],
"smiles": [
"CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CNC(=O)CCCC(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCc1nc2c(cnn2CC)c(NC2CCOCC2)c1CNC(=O)CCCC(=O)OC",
"role": "assistant"
}
] | |
121 | {
"selfies": [
"[C][O][C][=C][C][=C][C][Branch1][Branch1][C][C][C][O][=C][Ring1][#Branch2]"
],
"smiles": [
"COc1cccc(CCCO)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COc1cccc(CCC(=O)O)c1",
"role": "assistant"
}
] | |
122 | {
"selfies": [
"[C][O][C][=C][C][Branch1][C][N][=C][C][=C][Ring1][#Branch1][O][C][C][N][C][C][C][Branch1][C][O][C][Ring1][=Branch1]"
],
"smiles": [
"COc1cc(N)ccc1OCCN1CCC(O)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be COc1cc([N+](=O)[O-])ccc1OCCN1CCC(O)C1 .",
"role": "assistant"
}
] | |
123 | {
"selfies": [
"[N][C][=Branch1][C][=O][C][C][Branch1][#C][C][=C][C][=C][Branch1][C][F][C][Branch1][C][Cl][=C][Ring1][Branch2][=N][N][C][=Ring1][=N][C][N][C][Branch1][Branch1][C][C][Ring1][Ring1][C][Ring1][Branch2]"
],
"smiles": [
"NC(=O)c1c(-c2ccc(F)c(Cl)c2)nn2c1CNC1(CC1)C2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)N1Cc2c(C(N)=O)c(-c3ccc(F)c(Cl)c3)nn2CC12CC2",
"role": "assistant"
}
] | |
124 | {
"selfies": [
"[C][=C][C][=C][C][=C][Branch2][Ring1][Branch1][C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=N][C][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"C=Cc1ccc(Cn2c3ccccc3c3ccccc32)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "C=Cc1ccc(CCl)cc1.c1ccc2c(c1)[nH]c1ccccc12",
"role": "assistant"
}
] | |
125 | {
"selfies": [
"[C][C][=C][C][Branch2][Ring2][#Branch1][C][O][C][=C][C][=C][Branch2][Ring1][=Branch2][C][Branch1][C][O][C][Branch1][N][C][N][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][O][C][=C][Ring2][Ring1][=Branch1][=C][C][=C][C][=C][C][Ring1][=Branch1][=N][Ring2][Ring2][C]"
],
"smiles": [
"Cc1cc(COc2ccc(C(O)C(CNCc3ccccc3)C(=O)NO)cc2)c2ccccc2n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: Cc1cc(COc2ccc(C(O)C(CN(Cc3ccccc3)C(=O)OC(C)(C)C)C(=O)NO)cc2)c2ccccc2n1 .",
"role": "assistant"
}
] | |
126 | {
"selfies": [
"[C][C][Branch1][C][C][=C][C][C][C][Branch1][C][C][C][C][O][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CC(C)=CCCC(C)CCOC(=O)c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CC(C)=CCCC(C)CCO.O=C(O)c1ccccc1 .",
"role": "assistant"
}
] | |
127 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][N][Branch1][N][C][C][S][C][C][C][C][C][C][Ring1][=Branch1][C][C][C][Ring1][#C][C][C][C][Branch1][C][O][C][=C][C][=N][C][=C][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][N][Ring1][Branch2]"
],
"smiles": [
"COC(=O)C1CN(CCSC2CCCCC2)CCC1CCC(O)c1ccnc2ccc(OC)cc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)C1CNCCC1CCC(O)c1ccnc2ccc(OC)cc12.ClCCSC1CCCCC1",
"role": "assistant"
}
] | |
128 | {
"selfies": [
"[N][C][=C][C][=C][C][Branch2][Ring1][Ring1][C][C][C][N][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][N][=C][Ring2][Ring1][C]"
],
"smiles": [
"Nc1cccc(C2CCN(Cc3ccccc3)C2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "O=[N+]([O-])c1cccc(C2CCN(Cc3ccccc3)C2)c1",
"role": "assistant"
}
] | |
129 | {
"selfies": [
"[C][C][=C][C][Branch1][#Branch1][C][C][C][C][Ring1][Ring2][=C][Branch2][Ring1][#C][C][=N][C][=C][Branch1][Ring2][NH1][Ring1][Branch1][C][N][Branch1][=C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][C][Ring1][=C][C][=C][Ring2][Ring1][#Branch2][C][=Branch1][C][=O][N][C][C][C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][C][Ring1][=C]"
],
"smiles": [
"Cc1cc(C2CCC2)c(-c2nc3c([nH]2)CN(C(=O)OC(C)(C)C)CC3)cc1C(=O)N1CCC(c2ccc(C#N)cc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "Cc1cc(C2CCC2)c(-c2nc3c([nH]2)CN(C(=O)OC(C)(C)C)CC3)cc1C(=O)O.N#Cc1ccc(C2CCNCC2)cc1",
"role": "assistant"
}
] | |
130 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][C][F][C][Branch2][Ring2][#Branch2][C][=C][C][=C][Branch2][Ring1][Branch1][C][O][C][=N][C][=N][C][Branch1][Branch2][C][C][C][=Branch1][C][=O][O][=C][Ring1][O][C][N][=C][Ring2][Ring1][Ring2][C][C][Branch1][C][C][Branch1][C][C][C][=C][Ring2][Ring1][S]"
],
"smiles": [
"COc1ccc(F)c(-c2ccc(COc3ncnc(CCC(=O)O)c3C)nc2CC(C)(C)C)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CCOC(=O)CCc1ncnc(OCc2ccc(-c3cc(OC)ccc3F)c(CC(C)(C)C)n2)c1C",
"role": "assistant"
}
] | |
131 | {
"selfies": [
"[N][C][=Branch1][C][=O][C][C][C][C][N][Branch2][Ring2][=Branch1][C][=N][C][Branch2][Ring1][Branch1][N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][C][=Branch1][C][=O][N][Ring1][Branch2][=N][C][NH1][C][=C][C][Ring2][Ring1][Branch1][=Ring1][Branch1][C][C][Ring2][Ring1][O]"
],
"smiles": [
"NC(=O)CC1CCN(c2nc(Nc3ccc4c(c3)CCC(=O)N4)nc3[nH]ccc23)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "N.O=C(O)CC1CCN(c2nc(Nc3ccc4c(c3)CCC(=O)N4)nc3[nH]ccc23)CC1",
"role": "assistant"
}
] | |
132 | {
"selfies": [
"[C][C][=C][C][=C][N][=C][Ring1][=Branch1][C][O]"
],
"smiles": [
"Cc1cccnc1CO"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1ncccc1C",
"role": "assistant"
}
] | |
133 | {
"selfies": [
"[O][=S][=Branch1][C][=O][Branch1][S][N][C][=C][C][=C][C][=C][C][=C][N][=C][Ring1][#Branch2][Ring1][=Branch1][C][=C][C][=C][C][Branch1][C][Cl][=C][Ring1][#Branch1]"
],
"smiles": [
"O=S(=O)(Nc1cccc2cccnc12)c1cccc(Cl)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "Nc1cccc2cccnc12.O=S(=O)(Cl)c1cccc(Cl)c1",
"role": "assistant"
}
] | |
134 | {
"selfies": [
"[C][O][C][=C][C][=C][C][=C][Branch1][C][Br][C][=C][C][Ring1][#Branch1][=C][Ring1][O][C][N][C][=Branch1][C][=O][C][Branch2][Ring1][O][N][C][=Branch1][C][=O][C][Branch1][C][C][N][Branch1][C][C][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring2][Ring1][#Branch2]"
],
"smiles": [
"COc1ccc2cc(Br)ccc2c1CN1C(=O)C(NC(=O)C(C)N(C)C(=O)OC(C)(C)C)CNc2ccccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc2cc(Br)ccc2c1CN1C(=O)C(N)CNc2ccccc21.CC(C(=O)O)N(C)C(=O)OC(C)(C)C",
"role": "assistant"
}
] | |
135 | {
"selfies": [
"[C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][=Branch1][C][=O][N][Ring1][#Branch1]"
],
"smiles": [
"COc1ccccc1NS(=O)(=O)c1ccc2c(c1)CC(=O)N2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "COc1ccccc1N.O=C1Cc2cc(S(=O)(=O)Cl)ccc2N1",
"role": "assistant"
}
] | |
136 | {
"selfies": [
"[C][O][C][C][O][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][NH1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][Ring1][Branch2][=C][Ring1][#C]"
],
"smiles": [
"COCCOc1cc([N+](=O)[O-])c2[nH]c(C(=O)O)cc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CCOC(=O)c1cc2cc(OCCOC)cc([N+](=O)[O-])c2[nH]1 .",
"role": "assistant"
}
] | |
137 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C]"
],
"smiles": [
"CC(C)(CC(=O)O)NC(=O)OC(C)(C)C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(C)(N)CC(=O)O",
"role": "assistant"
}
] | |
138 | {
"selfies": [
"[O][=C][C][=C][C][=C][N][=C][C][=C][C][Ring1][=Branch1][=C][Ring1][#Branch2]"
],
"smiles": [
"O=Cc1ccc2ncccc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "OCc1ccc2ncccc2c1",
"role": "assistant"
}
] | |
139 | {
"selfies": [
"[C][N][C][C][N][Branch2][Ring1][Ring1][C][=Branch1][C][=O][N][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][=Branch2][C][=C][C][Branch2][Ring1][S][C][=C][C][=C][Branch1][=C][O][C][C][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=N][Ring2][Ring1][Ring2][=C][C][=C][Ring2][Ring1][#Branch2][Ring2][Ring2][#Branch2]"
],
"smiles": [
"CN1CCN(C(=O)Nc2nc3ccccc3s2)c2cc(-c3ccc(OCCCOc4ccccc4)c(C(=O)O)n3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1nc(-c2ccc3c(c2)N(C(=O)Nc2nc4ccccc4s2)CCN3C)ccc1OCCCOc1ccccc1",
"role": "assistant"
}
] | |
140 | {
"selfies": [
"[C][C][Branch2][Ring1][=Branch2][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][C][=C][Ring1][#Branch2][C][=C][C][=C][Branch1][#Branch2][N][S][Branch1][C][C][=Branch1][C][=O][=O][C][Branch1][O][C][#C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"CC(NC(=O)Nc1ccc(C(C)(C)C)cc1)c1ccc(NS(C)(=O)=O)c(C#Cc2ccccc2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)c1ccc(N=C=O)cc1.CC(N)c1ccc(NS(C)(=O)=O)c(C#Cc2ccccc2)c1 .",
"role": "assistant"
}
] | |
141 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][S][O][C][C][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][C][=C][Ring1][P][N]"
],
"smiles": [
"Cc1ccc(OCCc2ccc(C#N)cc2)cc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "Cc1ccc(OCCc2ccc(C#N)cc2)cc1[N+](=O)[O-]",
"role": "assistant"
}
] | |
142 | {
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=N][Ring1][=N]"
],
"smiles": [
"COc1cc(C(=O)O)cc(C(F)(F)F)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CO.O=C(O)c1cc(Cl)nc(C(F)(F)F)c1",
"role": "assistant"
}
] | |
143 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][C][Branch2][Ring1][Branch1][C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][O][N][=Ring1][N][=C][Ring2][Ring1][C]"
],
"smiles": [
"O=C(O)c1cccc(-c2cc(-c3ccc(Cl)cc3)on2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "COC(=O)c1cccc(-c2cc(-c3ccc(Cl)cc3)on2)c1",
"role": "assistant"
}
] | |
144 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][N][=N][Ring1][#Branch1]"
],
"smiles": [
"COC(=O)c1ccc(Cl)nn1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CO.O=C(O)c1ccc(Cl)nn1",
"role": "assistant"
}
] | |
145 | {
"selfies": [
"[N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=Branch1][C][=O][NH1][C][=Branch1][C][=O][N][Ring1][=Branch2][C][C][=C][C][=C][C][Branch2][Ring1][#Branch1][C][=Branch1][C][=O][N][C][C][N][Branch1][=Branch2][C][=N][C][=C][C][=N][Ring1][=Branch1][C][C][Ring1][N][=C][Ring2][Ring1][Ring2]"
],
"smiles": [
"Nc1ccc2c(c1)c(=O)[nH]c(=O)n2Cc1cccc(C(=O)N2CCN(c3ncccn3)CC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be O=C(c1cccc(Cn2c(=O)[nH]c(=O)c3cc([N+](=O)[O-])ccc32)c1)N1CCN(c2ncccn2)CC1 .",
"role": "assistant"
}
] | |
146 | {
"selfies": [
"[C][N][C][C][C][Branch2][Ring2][#Branch2][N][C][=Branch1][C][=O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][=C][Branch2][Ring1][C][N][C][=N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][S][Ring1][#Branch2][N][Ring1][P][C][C][Ring2][Ring1][=N]"
],
"smiles": [
"CN1CCC(NC(=O)c2ccc3c(c2)nc(Nc2nc4ccc(Cl)cc4s2)n3C)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "C=O.Cn1c(Nc2nc3ccc(Cl)cc3s2)nc2cc(C(=O)NC3CCNC3)ccc21",
"role": "assistant"
}
] | |
147 | {
"selfies": [
"[C][C][N][Branch2][Ring2][=Branch2][C][Branch1][C][C][Branch1][C][C][C][=Branch1][C][=O][N][Branch1][C][C][C][C][C][C][C][C][Ring1][=Branch1][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][Branch1][Ring2][C][Ring1][=Branch2][C][Ring1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C]"
],
"smiles": [
"CCN(C(C)(C)C(=O)N(C)C1C2CC3CC1CC(C(=O)O)(C3)C2)S(=O)(=O)c1ccccc1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: CCN(C(C)(C)C(=O)N(C)C1C2CC3CC1CC(C(=O)[O-])(C3)C2)S(=O)(=O)c1ccccc1C .",
"role": "assistant"
}
] | |
148 | {
"selfies": [
"[C][O][C][=C][C][Branch2][Ring2][=Branch1][C][=C][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][O][C][C][=C][Branch1][C][C][C][C][=C][C][C][Branch1][C][C][=C][C][=Branch1][C][=O][O][C][Ring2][Ring1][C][=Ring1][Branch2][=C][C][Branch1][Ring1][O][C][=C][Ring2][Ring1][=C][O][C]"
],
"smiles": [
"COc1cc(C=CC(=O)c2c(OCC=C(C)C)ccc3c(C)cc(=O)oc23)cc(OC)c1OC"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(=O)c1c(OCC=C(C)C)ccc2c(C)cc(=O)oc12.COc1cc(C=O)cc(OC)c1OC .",
"role": "assistant"
}
] | |
149 | {
"selfies": [
"[C][O][N][Branch1][C][C][C][=Branch1][C][=O][C][=C][C][=C][C][Branch2][Ring1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#C][N+1][=Branch1][C][=O][O-1]"
],
"smiles": [
"CON(C)C(=O)c1cccc(CO[Si](C)(C)C(C)(C)C)c1[N+](=O)[O-]"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): CC(C)(C)[Si](C)(C)Cl.CON(C)C(=O)c1cccc(CO)c1[N+](=O)[O-] .",
"role": "assistant"
}
] | |
150 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch2][Ring2][S][C][N][Branch2][Ring1][#Branch1][C][C][C][=C][C][=C][C][Branch1][O][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1][=C][Ring1][=C][C][=Branch1][C][=O][C][=C][C][Branch1][C][Cl][=C][C][C][=C][NH1][C][Ring1][#Branch2][=Ring1][Branch1][C][=C][Ring2][Ring2][Ring2]"
],
"smiles": [
"CC(C)(C)c1ccc(CN(CCc2cccc(OCc3ccccc3)c2)C(=O)c2cc(Cl)cc3cc[nH]c23)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(C)(C)c1ccc(CNCCc2cccc(OCc3ccccc3)c2)cc1.O=C(O)c1cc(Cl)cc2cc[nH]c12 .",
"role": "assistant"
}
] | |
151 | {
"selfies": [
"[C][C][C][C][C][C][C][Ring1][=Branch1][O][C][=C][C][Branch1][C][Cl][=N][C][=N][Ring1][#Branch1]"
],
"smiles": [
"CC1CCCCC1Oc1cc(Cl)ncn1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC1CCCCC1O.Clc1cc(Cl)ncn1",
"role": "assistant"
}
] | |
152 | {
"selfies": [
"[C][C][=C][C][=C][Branch1][C][Cl][C][Branch1][P][O][C][=C][C][Branch1][C][Br][=C][C][Branch1][C][F][=C][Ring1][Branch2][Cl][=C][Ring1][P][F]"
],
"smiles": [
"Cc1ccc(Cl)c(Oc2cc(Br)cc(F)c2Cl)c1F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Cc1ccc(Cl)c(O)c1F.Fc1cc(Br)cc(F)c1Cl",
"role": "assistant"
}
] | |
153 | {
"selfies": [
"[C][C][=C][C][=C][C][=C][C][Branch1][=Branch1][C][Branch1][C][C][C][=C][Ring1][=Branch2][N][Ring1][N][C]"
],
"smiles": [
"Cc1cc2cccc(C(C)C)c2n1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CI.Cc1cc2cccc(C(C)C)c2[nH]1",
"role": "assistant"
}
] | |
154 | {
"selfies": [
"[C][C][=C][C][=C][C][Branch2][Ring1][S][N][C][=Branch1][C][=O][N][C][C][C][N][Branch1][S][C][C][C][=C][NH1][C][=C][C][=C][C][=C][Ring1][=Branch2][Ring1][=Branch1][C][C][Ring1][P][=C][Ring2][Ring1][O]"
],
"smiles": [
"Cc1cccc(NC(=O)NC2CCN(CCc3c[nH]c4ccccc34)CC2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "Cc1cccc(N=C=O)c1.NC1CCN(CCc2c[nH]c3ccccc23)CC1",
"role": "assistant"
}
] | |
155 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][O][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][Branch1][#Branch1][C][C][=Branch1][C][=O][O][=C][Branch1][C][C][N][Ring1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"CCOC(=O)COc1ccc2c(c1)c(CC(=O)O)c(C)n2Cc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)CBr.Cc1c(CC(=O)O)c2cc(O)ccc2n1Cc1ccccc1",
"role": "assistant"
}
] | |
156 | {
"selfies": [
"[N][#C][C][=C][C][=C][Branch2][Ring1][Ring2][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][Branch1][C][F][=C][Ring1][#Branch2][C][=C][N][=C][Ring1][P][C][=C][Ring2][Ring1][Branch1][O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"N#Cc1cc2c(Oc3ccc([N+](=O)[O-])c(F)c3)ccnc2cc1OCc1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "N#Cc1cc2c(Cl)ccnc2cc1OCc1ccccc1.O=[N+]([O-])c1ccc(O)cc1F",
"role": "assistant"
}
] | |
157 | {
"selfies": [
"[O][=N+1][Branch1][C][O-1][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][O][C][C][C][C][Ring1][Ring1]"
],
"smiles": [
"O=[N+]([O-])c1ccc(F)cc1OCC1CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "O=[N+]([O-])c1ccc(F)cc1F.OCC1CC1",
"role": "assistant"
}
] | |
158 | {
"selfies": [
"[O][=C][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=Branch2][=C][N][C][=C][C][=C][Branch1][=Branch1][O][C][C][C][Cl][C][=C][Ring1][O]"
],
"smiles": [
"O=C1Nc2ccccc2C1=CNc1ccc(OCCCCl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: ClCCCBr.O=C1Nc2ccccc2C1=CNc1ccc(O)cc1 .",
"role": "assistant"
}
] | |
159 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][O][C][=C][C][=C][Branch2][Ring1][#Branch2][O][C][C][C][N][=C][Branch1][=N][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2][O][C][=Ring1][=N][C][C][=C][Ring2][Ring1][#Branch1]"
],
"smiles": [
"CCOC(=O)C(C)(C)Oc1ccc(OCCc2nc(-c3ccc(C#N)cc3)oc2C)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CCOC(=O)C(C)(C)Oc1ccc(OCCc2nc(-c3ccc(Br)cc3)oc2C)cc1.N#C[Cu] .",
"role": "assistant"
}
] | |
160 | {
"selfies": [
"[N][C][=N][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][Ring1][N][F]"
],
"smiles": [
"Nc1ncccc1-c1ccc(-c2ccccc2)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be Nc1ncccc1Br.OB(O)c1ccc(-c2ccccc2)cc1F .",
"role": "assistant"
}
] | |
161 | {
"selfies": [
"[Br][C][=C][C][=C][Branch2][Ring1][Ring2][C][N][C][C][S][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][N][C][=C][Ring2][Ring1][Ring1]"
],
"smiles": [
"Brc1ccc(CN2CCSC(c3ccccc3)C2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): BrCc1ccc(Br)cc1.c1ccc(C2CNCCS2)cc1 .",
"role": "assistant"
}
] | |
162 | {
"selfies": [
"[N][#C][C][=C][C][=C][Branch2][Ring2][Ring2][C][C][=C][Branch2][Ring1][=Branch2][C][C][N][C][=Branch1][C][=O][C][C][=C][Branch1][=Branch2][C][=C][C][=C][N][=C][Ring1][=Branch1][NH1][N][=Ring1][O][O][N][=Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][O][Cl]"
],
"smiles": [
"N#Cc1ccc(-c2cc(CCNC(=O)c3cc(-c4cccnc4)[nH]n3)on2)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "N#Cc1ccc(-c2cc(CCN)on2)cc1Cl.O=C(O)c1cc(-c2cccnc2)[nH]n1",
"role": "assistant"
}
] | |
163 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch2][Ring1][P][C][C][=C][Branch1][Ring1][C][O][C][=Branch1][C][=O][N][Branch1][#C][C][C][=C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][N][=Ring2][Ring1][Ring1][C][=C][Ring2][Ring1][=Branch2][F]"
],
"smiles": [
"COc1ccc(-c2cc(CO)c(=O)n(CC=Cc3ccc(Cl)cc3)n2)cc1F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(-c2cc(C(=O)O)c(=O)n(CC=Cc3ccc(Cl)cc3)n2)cc1F",
"role": "assistant"
}
] | |
164 | {
"selfies": [
"[C][N][C][Branch1][C][N][=C][Branch1][Ring1][C][#N][C][=C][C][Branch2][Ring1][C][O][C][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][=C][C][=C][Ring1][P][Ring2][Ring1][#Branch1]"
],
"smiles": [
"Cn1c(N)c(C#N)c2cc(OCc3cccc([N+](=O)[O-])c3)ccc21"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "Cn1c(N)c(C#N)c2cc(O)ccc21.O=[N+]([O-])c1cccc(CBr)c1",
"role": "assistant"
}
] | |
165 | {
"selfies": [
"[C][O][C][C][C][O][C][=C][C][=N][C][Branch2][Ring1][Ring1][C][S][=Branch1][C][=O][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2][=C][Ring2][Ring1][C][C]"
],
"smiles": [
"COCCCOc1ccnc(CS(=O)c2nc3ccccc3[nH]2)c1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "COCCCOc1ccnc(CSc2nc3ccccc3[nH]2)c1C.O=C(OO)c1cccc(Cl)c1",
"role": "assistant"
}
] | |
166 | {
"selfies": [
"[C][C][Branch1][C][C][Branch1][C][C][Si][Branch1][C][C][Branch1][C][C][O][C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][N][Ring1][Branch2][C][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CC(C)(C)[Si](C)(C)OCc1ccc(C(=O)O)n1CC(=O)c1ccc(Cl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1ccc(CO[Si](C)(C)C(C)(C)C)n1CC(=O)c1ccc(Cl)cc1",
"role": "assistant"
}
] | |
167 | {
"selfies": [
"[O][=C][Branch1][Ring2][C][C][O][N][C][=N][C][Branch2][Ring1][=Branch2][C][N][C][C][C][Branch1][=C][C][=C][NH1][C][=C][C][=C][C][=C][Ring1][=Branch2][Ring1][=Branch1][C][C][Ring1][#C][=C][S][Ring2][Ring1][Branch1]"
],
"smiles": [
"O=C(CCO)Nc1nc(CN2CCC(c3c[nH]c4ccccc34)CC2)cs1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CC(=O)OCCC(=O)Nc1nc(CN2CCC(c3c[nH]c4ccccc34)CC2)cs1 .",
"role": "assistant"
}
] | |
168 | {
"selfies": [
"[C][O][C][=C][C][Branch1][=Branch2][C][=Branch1][C][=O][N][C][C][O][=C][C][=C][Ring1][N][N][C][=N][C][=C][C][=Branch1][Ring2][=N][Ring1][=Branch1][N][Branch1][Branch2][C][C][C][C][C][Ring1][Branch1][C][C][Branch1][C][F][Branch1][C][F][C][=Branch1][C][=O][N][Ring1][S][C]"
],
"smiles": [
"COc1cc(C(=O)NCCO)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC(F)(F)C(=O)N2C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "<molecule_2d> Given the product provided, propose some possible reactants that could have been employed in its formation.",
"role": "user"
},
{
"content": "Here are possible reactants: COc1cc(C(=O)O)ccc1Nc1ncc2c(n1)N(C1CCCC1)CC(F)(F)C(=O)N2C.NCCO .",
"role": "assistant"
}
] | |
169 | {
"selfies": [
"[C][C][=C][C][=C][N][=C][Ring1][=Branch1][C][C][C][C][C][Branch1][#Branch2][C][=N][C][=C][C][=C][Ring1][=Branch1][C][N][Ring1][=N][C][C][C][=C][C][=C][C][=N][Ring1][=Branch1]"
],
"smiles": [
"Cc1cccnc1C1CCCC(c2ncccc2C)N1CCc1ccccn1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CS(=O)(=O)OCCc1ccccn1.Cc1cccnc1C1CCCC(c2ncccc2C)N1",
"role": "assistant"
}
] | |
170 | {
"selfies": [
"[C][C][C][C][C][C][N][C][C][C][C][Branch2][Ring2][S][C][O][C][=C][C][=C][Branch2][Ring2][C][C][=Branch1][C][=O][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1][S][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][P][Ring1][#Branch1][C][=C][Ring2][Ring1][=Branch2][C][Ring2][Ring1][P]"
],
"smiles": [
"CCCCCCN1CCCC(COc2ccc(C(=O)c3c(-c4ccc(O)cc4)sc4cc(O)ccc34)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "CCCCCCN1CCCC(COc2ccc(C(=O)c3c(-c4ccc(OC)cc4)sc4cc(OC)ccc34)cc2)C1",
"role": "assistant"
}
] | |
171 | {
"selfies": [
"[N][C][=C][C][=C][Branch2][Ring1][N][C][=C][C][=C][C][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][O][C][Ring1][P][=Ring1][=N][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring2][Ring1][=C][=Ring1][=Branch2]"
],
"smiles": [
"Nc1ccc(-c2cccc3c(=O)cc(N4CCOCC4)oc23)c2oc3ccccc3c12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "O=c1cc(N2CCOCC2)oc2c(-c3ccc([N+](=O)[O-])c4c3oc3ccccc34)cccc12",
"role": "assistant"
}
] | |
172 | {
"selfies": [
"[C][=C][C][C][Branch1][Ring1][C][=C][O][C][C][C][C][C][C][C][C][C][C][O][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2]"
],
"smiles": [
"C=CCC(C=C)OCCCCCCCCCCOc1ccc(C(=O)O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "C=CCC(C=C)OCCCCCCCCCCOc1ccc(C(=O)OC)cc1",
"role": "assistant"
}
] | |
173 | {
"selfies": [
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][C][=N][N][Branch1][C][C][C][=Ring1][=Branch1][C][=Branch1][C][=O][N][C][C][=C][N][N][=C][Branch1][=Branch2][N][C][C][O][C][C][Ring1][=Branch1][N][=C][Ring1][O][C][=Ring1][#C]"
],
"smiles": [
"CN(C)C(=O)c1cnn(C)c1C(=O)Nc1ccn2nc(N3CCOCC3)nc2c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CNC.Cn1ncc(C(=O)O)c1C(=O)Nc1ccn2nc(N3CCOCC3)nc2c1",
"role": "assistant"
}
] | |
174 | {
"selfies": [
"[C][C][C][O][C][=N][C][Branch1][=N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][=N][C][O][C][Branch2][Ring1][=Branch1][C][=C][C][Branch1][C][C][=C][Branch1][=Branch1][O][C][C][C][Br][C][Branch1][C][C][=C][Ring1][=N][=N][C][Ring2][Ring1][=C][=Ring2][Ring1][C]"
],
"smiles": [
"CCCOc1nc(Cc2ccc(Cl)cc2)nc2oc(-c3cc(C)c(OCCCBr)c(C)c3)nc12"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "BrCCCBr.CCCOc1nc(Cc2ccc(Cl)cc2)nc2oc(-c3cc(C)c(O)c(C)c3)nc12",
"role": "assistant"
}
] | |
175 | {
"selfies": [
"[C][C][=C][C][=C][C][Branch2][Ring1][=Branch1][C][#C][C][=C][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][N][=N][Ring2][Ring1][Branch1]"
],
"smiles": [
"Cc1cccc(C#CC=C2CCN(c3ccccc3)CC2)n1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "Brc1ccccc1.Cc1cccc(C#CC=C2CCNCC2)n1",
"role": "assistant"
}
] | |
176 | {
"selfies": [
"[N][C][=C][C][=C][C][Branch2][Ring1][=C][S][=Branch1][C][=O][=Branch1][C][=O][N][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Ring1][N][=C][Ring2][Ring1][Branch1]"
],
"smiles": [
"Nc1cccc(S(=O)(=O)N2CC(C(=O)O)CC(C(=O)O)C2)c1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "O=C(O)C1CC(C(=O)O)CN(S(=O)(=O)c2cccc([N+](=O)[O-])c2)C1",
"role": "assistant"
}
] | |
177 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][=C][C][Branch1][C][Cl][=C][C][=C][Ring1][#Branch1][C][=C][C][=Branch1][C][=O][N][C][C][N][Branch1][=N][C][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][C][Ring1][=C][C]"
],
"smiles": [
"CC(=O)Nc1cc(Cl)ccc1C=CC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1C"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(=O)Nc1cc(Cl)ccc1C=CC(=O)O.CC1CN(Cc2ccc(Cl)cc2)CCN1",
"role": "assistant"
}
] | |
178 | {
"selfies": [
"[C][N][Branch1][C][C][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][C][=C][C][=C][Branch1][=Branch2][C][=Branch1][C][=O][C][C][C][Cl][C][=C][Ring1][N]"
],
"smiles": [
"CN(C)C(=O)C(C)(C)c1ccc(C(=O)CCCCl)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Do retrosynthesis with the product <molecule_2d> .",
"role": "user"
},
{
"content": "OK. The reactants may be CN(C)C(=O)C(C)(C)c1ccccc1.O=C(Cl)CCCCl .",
"role": "assistant"
}
] | |
179 | {
"selfies": [
"[N][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][N][=C][Ring1][#Branch1][N]"
],
"smiles": [
"NC(=O)c1ccc(N)nc1N"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "Nc1ccc(C(=O)O)c(N)n1.[NH4+]",
"role": "assistant"
}
] | |
180 | {
"selfies": [
"[C][C][=C][C][Branch2][Ring1][P][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][Branch1][P][O][Si][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][=C][Ring1][=C][=C][C][Branch1][C][C][=C][Ring2][Ring1][=Branch2][O]"
],
"smiles": [
"Cc1cc(C(=O)NCc2cccc(O[Si](C)(C)C(C)(C)C)c2)cc(C)c1O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: CC(C)(C)[Si](C)(C)Oc1cccc(CN)c1.Cc1cc(C(=O)O)cc(C)c1O .",
"role": "assistant"
}
] | |
181 | {
"selfies": [
"[C][O][C][C][C][C][C][O][C][C][C][N][Branch2][Ring2][#Branch2][C][=C][C][=C][Branch2][Ring1][=C][C][=N][N][C][=C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][=Branch2][N][=C][Ring1][=C][S][Ring1][P][C][=C][Ring2][Ring1][#Branch1][C][C][Ring2][Ring1][=N]"
],
"smiles": [
"COCCCCCOC1CCN(c2ccc(-c3nn4cc(-c5ccc(C(=O)O)cc5)nc4s3)cc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "CCOC(=O)c1ccc(-c2cn3nc(-c4ccc(N5CCC(OCCCCCOC)CC5)cc4)sc3n2)cc1",
"role": "assistant"
}
] | |
182 | {
"selfies": [
"[C][C][C][O][C][C][N][Ring1][=Branch1][C][=N][C][Branch1][N][C][=C][N][=C][Branch1][C][N][N][=C][Ring1][#Branch1][=C][C][=Branch1][Ring2][=N][Ring1][=N][N][Branch2][Ring2][Branch2][C][Branch1][C][C][C][C][N][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][C][Branch1][C][C][Branch1][C][C][N][C][=Branch1][C][=O][O][C][Branch1][C][C][Branch1][C][C][C][C][Ring2][Ring1][Ring1][C][C][Ring2][Ring1][=Branch2]"
],
"smiles": [
"CC1COCCN1c1nc(-c2cnc(N)nc2)c2c(n1)N(C1(C)CCN(C(=O)C(C)(C)NC(=O)OC(C)(C)C)C1)CC2"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)OC(=O)NC(C)(C)C(=O)O.CC1COCCN1c1nc(-c2cnc(N)nc2)c2c(n1)N(C1(C)CCNC1)CC2",
"role": "assistant"
}
] | |
183 | {
"selfies": [
"[C][O][C][=Branch1][C][=O][C][C][N][Branch1][=C][C][=C][C][=C][Branch1][Ring2][C][=N][O][C][=C][Ring1][=Branch2][C][Ring1][=N]"
],
"smiles": [
"COC(=O)C1CN(c2ccc(C=NO)cc2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "COC(=O)C1CN(c2ccc(C=O)cc2)C1.NO",
"role": "assistant"
}
] | |
184 | {
"selfies": [
"[C][O][C][=C][C][O][C][=Branch1][C][=O][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=Ring1][O][C][=C][Ring1][#C][O][C][C][C][N][C][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][N]"
],
"smiles": [
"COc1cc2oc(=O)cc(C(F)(F)F)c2cc1OCCCN1CCC(c2ccccc2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COc1cc2oc(=O)cc(C(F)(F)F)c2cc1O.ClCCCN1CCC(c2ccccc2)CC1",
"role": "assistant"
}
] | |
185 | {
"selfies": [
"[C][C][C][=Branch1][C][=O][N][C][C][Branch2][Ring1][=Branch1][C][=Branch1][C][=O][N][C][C][C][N][Branch1][#Branch1][C][C][C][C][Ring1][Ring2][C][C][Ring1][O][C][Ring1][P]"
],
"smiles": [
"CCC(=O)N1CC(C(=O)N2CCCN(C3CCC3)CC2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "With the given product <molecule_2d>, suggest some likely reactants that were used in its synthesis.",
"role": "user"
},
{
"content": "CCC(=O)Cl.O=C(C1CNC1)N1CCCN(C2CCC2)CC1",
"role": "assistant"
}
] | |
186 | {
"selfies": [
"[N][C][=C][C][=C][Branch1][Branch2][O][C][C][C][C][Ring1][Ring1][C][=C][Ring1][O][C][Branch1][C][F][Branch1][C][F][F]"
],
"smiles": [
"Nc1ccc(OCC2CC2)cc1C(F)(F)F"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "O=[N+]([O-])c1ccc(OCC2CC2)cc1C(F)(F)F",
"role": "assistant"
}
] | |
187 | {
"selfies": [
"[O][=C][Branch1][Ring1][N][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]"
],
"smiles": [
"O=C(NO)c1ccccc1-c1ccccc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "To synthesis <molecule_2d>, what are the possible reactants? Write in the SMILES representation.",
"role": "user"
},
{
"content": "NO.O=C(O)c1ccccc1-c1ccccc1",
"role": "assistant"
}
] | |
188 | {
"selfies": [
"[C][C][=Branch1][C][=O][N][C][C][C][N][Branch2][=Branch1][=Branch2][C][C][=C][C][=C][C][Branch2][Branch1][N][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=Branch2][N][C][C][C][C][C][Ring1][=Branch1][C][=C][Ring1][N][C][=C][C][Branch2][Ring1][=Branch2][C][=Branch1][C][=O][N][C][C][=C][C][=C][C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][=C][Ring1][#Branch2][=C][C][=N][Ring2][Ring1][Ring2][=N][Ring2][Ring2][=Branch2][C][C][Ring2][Ring2][P]"
],
"smiles": [
"CC(=O)N1CCCN(Cc2cccc(C(=O)Nc3ccc(N4CCCCC4)cc3-c3cc(C(=O)NCc4cccc(C(F)(F)F)c4)ccn3)n2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "CC(=O)Cl.O=C(NCc1cccc(C(F)(F)F)c1)c1ccnc(-c2cc(N3CCCCC3)ccc2NC(=O)c2cccc(CN3CCCNCC3)n2)c1",
"role": "assistant"
}
] | |
189 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][Branch1][S][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][=C][Ring1][#C][Cl]"
],
"smiles": [
"O=C(O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1Cl"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "What reactants could lead to the production of the following product? <molecule_2d>",
"role": "user"
},
{
"content": "COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1Cl",
"role": "assistant"
}
] | |
190 | {
"selfies": [
"[O][=C][Branch1][C][O][C][=C][C][=C][C][=N][C][=C][Ring1][=Branch1][NH1][C][Ring1][#Branch2][=O]"
],
"smiles": [
"O=C(O)c1cc2ccncc2[nH]c1=O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you identify the reactant(s) that might result in the given product <molecule_2d> ?",
"role": "user"
},
{
"content": "COC(=O)c1cc2ccncc2[nH]c1=O",
"role": "assistant"
}
] | |
191 | {
"selfies": [
"[C][C][O][C][=N][C][=C][Branch2][Ring1][Ring2][B][O][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][O][Ring1][=Branch2][C][=C][Ring1][#C][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][O][C][=C][Ring1][#Branch1]"
],
"smiles": [
"CCOc1ncc(B2OC(C)(C)C(C)(C)O2)cc1NS(=O)(=O)c1ccc(O)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.CCOc1ncc(Br)cc1NS(=O)(=O)c1ccc(O)cc1",
"role": "assistant"
}
] | |
192 | {
"selfies": [
"[N][#C][C][C][=Branch1][C][=O][N][C][C][C][C][Branch2][Ring2][#Branch2][N][C][C][=C][Branch1][#Branch1][N][C][C][C][Ring1][Ring1][C][=N][C][=C][Branch1][P][C][=Branch1][C][=O][N][C][=C][C][=N][C][Branch1][C][Cl][=C][Ring1][#Branch1][N][Ring1][#C][N][=Ring2][Ring1][#Branch1][C][C][Ring2][Ring1][=C]"
],
"smiles": [
"N#CCC(=O)NC1CCC(Nc2cc(NC3CC3)c3ncc(C(=O)Nc4ccnc(Cl)c4)n3n2)CC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Could you tell which reactants might have been used to generate the following product? <molecule_2d>",
"role": "user"
},
{
"content": "N#CCC(=O)O.NC1CCC(Nc2cc(NC3CC3)c3ncc(C(=O)Nc4ccnc(Cl)c4)n3n2)CC1",
"role": "assistant"
}
] | |
193 | {
"selfies": [
"[C][C][O][C][=Branch1][C][=O][N][C][C][N][Branch2][Ring1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][N][C][=C][C][=C][Branch1][C][F][C][=C][Ring1][#Branch1][S][Ring1][N][C][Branch1][#C][C][=Branch1][C][=O][N][O][C][C][C][C][C][O][Ring1][=Branch1][C][Ring2][Ring1][#C]"
],
"smiles": [
"CCOC(=O)N1CCN(S(=O)(=O)c2ccc(-c3ccc(F)cc3)s2)C(C(=O)NOC2CCCCO2)C1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Based on the given product, provide some plausible reactants that might have been utilized to prepare it. <molecule_2d>",
"role": "user"
},
{
"content": "CCOC(=O)Cl.O=C(NOC1CCCCO1)C1CNCCN1S(=O)(=O)c1ccc(-c2ccc(F)cc2)s1",
"role": "assistant"
}
] | |
194 | {
"selfies": [
"[C][C][O][N][=C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][F][C][=Ring1][N][C][=Branch1][C][=O][O]"
],
"smiles": [
"Cc1onc(-c2ccccc2F)c1C(=O)O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Given the following product, please provide possible reactants. <molecule_2d>",
"role": "user"
},
{
"content": "Possible reactant(s): COC(=O)c1c(-c2ccccc2F)noc1C .",
"role": "assistant"
}
] | |
195 | {
"selfies": [
"[C][O][C][=C][C][=C][Branch1][=Branch2][C][Branch1][C][F][Branch1][C][F][F][C][=C][Ring1][#Branch2][N][C][=Branch1][C][=O][N][C][=C][Branch1][C][F][C][=C][C][=C][Ring1][#Branch1][Br]"
],
"smiles": [
"COc1ccc(C(F)(F)F)cc1NC(=O)Nc1c(F)cccc1Br"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Suggest possible substances that may have been involved in the synthesis of the presented compound. <molecule_2d>",
"role": "user"
},
{
"content": "COc1ccc(C(F)(F)F)cc1N=C=O.Nc1c(F)cccc1Br",
"role": "assistant"
}
] | |
196 | {
"selfies": [
"[O][C][=C][C][C][=N][NH1][C][=Ring1][Branch1][C][=C][Ring1][=Branch2][Br]"
],
"smiles": [
"Oc1cc2cn[nH]c2cc1Br"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "COc1cc2cn[nH]c2cc1Br",
"role": "assistant"
}
] | |
197 | {
"selfies": [
"[N][S][=Branch1][C][=O][=Branch1][C][=O][O][C][C][C][C][C][Branch2][Ring1][#C][N][C][=C][C][=C][Branch1][#C][N][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][=Branch2][N][=C][N][=C][Ring1][S][Ring2][Ring1][Ring1][C][C][Ring2][Ring1][Branch2][O]"
],
"smiles": [
"NS(=O)(=O)OCCC1CC(n2ccc3c(NC4CCc5ccccc54)ncnc32)CC1O"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Identify possible reactants that could have been used to create the specified product. <molecule_2d>",
"role": "user"
},
{
"content": "CC(C)(C)[Si](C)(C)OC1CC(n2ccc3c(NC4CCc5ccccc54)ncnc32)CC1CCOS(N)(=O)=O",
"role": "assistant"
}
] | |
198 | {
"selfies": [
"[Cl][C][=N][C][=C][N][=C][Ring1][=Branch1][N][C][C][O][C][C][Ring1][=Branch1]"
],
"smiles": [
"Clc1nccnc1N1CCOCC1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Can you list the reactants that might result in the chemical product <molecule_2d> ?",
"role": "user"
},
{
"content": "C1COCCN1.Clc1nccnc1Cl",
"role": "assistant"
}
] | |
199 | {
"selfies": [
"[C][C][=C][C][=C][Branch2][Ring2][C][C][=C][C][Branch1][=Branch1][C][=Branch1][C][=O][O][=C][C][Branch1][S][N][N][=N][N][=C][Ring1][Branch1][C][Branch1][C][F][Branch1][C][F][F][=C][Ring2][Ring1][C][C][=C][Ring2][Ring1][Branch2]"
],
"smiles": [
"Cc1ccc(-c2cc(C(=O)O)cc(-n3nnnc3C(F)(F)F)c2)cc1"
]
} | [
{
"content": "You are a chemist. Now you are given a product molecule. Please predict the the reactant molecules of the reaction.\nThe reaction equation has the following format:\n```\nreactant1.reactant2. ... .reactantN>>product\n```\nYour task is to predict the structure representation of the reactant molecule. We provide the SMILES of the reactants.",
"role": "system"
},
{
"content": "Provide the potential reactants that may be used to produce the product <molecule_2d> .",
"role": "user"
},
{
"content": "The potential reactants: COC(=O)c1cc(-c2ccc(C)cc2)cc(-n2nnnc2C(F)(F)F)c1 .",
"role": "assistant"
}
] |
Subsets and Splits