conversations
stringlengths 109
9.01k
|
---|
[{"from": "human", "value": "Write a possible SMILES of given compound. -> Chlorzoxazone\n"}, {"from": "gpt", "value": " Clc2ccc1oc(=O)[nH]c1c2\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C9H13ClN6/c1-4-12-7-13-6(10)14-8(15-7)16-9(2,3)5-11/h4H2,1-3H3,(H2,12,13,14,15,16)\n"}, {"from": "gpt", "value": " Cyanazine\n"}] |
[{"from": "human", "value": "Write water solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C. -> CCCOC(=O)CCC\n"}, {"from": "gpt", "value": " -1.75\n"}] |
[{"from": "human", "value": "Write a possible SELFIES of given compound. -> Mebendazole\n"}, {"from": "gpt", "value": " [C][O][C][=Branch1][C][=O][N][C][=N][C][=C][C][=C][Branch1][Branch2][C][=C][Ring1][=Branch1][NH1][Ring1][=Branch2][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> InChI=1S/C20H16/c1-13-16-8-5-6-9-17(16)14(2)20-18(13)12-11-15-7-3-4-10-19(15)20/h3-12H,1-2H3\n"}, {"from": "gpt", "value": " -7.02\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given SMILES in room temperature. -> CC12CC(=O)C3C(CCC4=CC(=O)CCC34C)C2CCC1(O)C(=O)CO\n"}, {"from": "gpt", "value": " 0.0007762471166286919 mol/L\n"}] |
[{"from": "human", "value": "What is water solubility of given SELFIES in 25 \u00b0C? -> [C][C][C][C][O][C]\n"}, {"from": "gpt", "value": " 0.10232929922807542 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C16H14/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16/h3-10H,1-2H3\n"}, {"from": "gpt", "value": " 9,10-Dimethylanthracene\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> Oc1ccc(Cl)c(Cl)c1Cl\n"}, {"from": "gpt", "value": " 2,3,4-Trichlorophenol\n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> 2-Chloroanisole\n"}, {"from": "gpt", "value": " InChI=1S/C7H7ClO/c1-9-7-5-3-2-4-6(7)8/h2-5H,1H3\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][C][N][=Branch1][C][=O][=O]\n"}, {"from": "gpt", "value": " 1-Nitropropane\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [F][C][Branch1][C][F][Branch1][C][F][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][N][C][C][Branch1][Ring1][C][Cl][C][Branch1][C][Cl][C][Ring1][Branch2][=O]\n"}, {"from": "gpt", "value": " Flurochloridone\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> ClC1(C2(Cl)C3(Cl)C4(Cl)C5(Cl)C1(Cl)C3(Cl)Cl)C5(Cl)C(Cl)(Cl)C24Cl\n"}, {"from": "gpt", "value": " Mirex\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C24H38O4/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3\n"}, {"from": "gpt", "value": " Di(2-ethylhexyl)-phthalate\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given SMILES in room temperature. -> CCCCS\n"}, {"from": "gpt", "value": " -2.18\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][C][O][C]\n"}, {"from": "gpt", "value": " Methyl propyl ether \n"}] |
[{"from": "human", "value": "Given SMILES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> CC(=O)OC3(CCC4C2CCC1=CC(=O)CCC1C2CCC34C)C#C\n"}, {"from": "gpt", "value": " -4.8\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> CON(C)C(=O)Nc1ccc(Br)c(Cl)c1\n"}, {"from": "gpt", "value": " Chlorbromuron\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> ClC(Cl)Cl\n"}, {"from": "gpt", "value": " Trichloromethane\n"}] |
[{"from": "human", "value": "Write water solubility of given InChI in 25 \u00b0C. -> InChI=1S/C5H6N2O2/c1-7-3-2-4(8)6-5(7)9/h2-3H,1H3,(H,6,8,9)\n"}, {"from": "gpt", "value": " 0.15595525028269536 mol/L\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][O][C][C][O][C][C]\n"}, {"from": "gpt", "value": " 1,2-Diethoxyethane \n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> Methanol\n"}, {"from": "gpt", "value": " InChI=1S/CH4O/c1-2/h2H,1H3\n"}] |
[{"from": "human", "value": "What will be SELFIES of given compound? -> allicin\n"}, {"from": "gpt", "value": " [C][=C][C][S][=Branch1][C][=O][S][C][C][=C]\n"}] |
[{"from": "human", "value": "Given compound, write its InChI. -> Cycloheptanol\n"}, {"from": "gpt", "value": " InChI=1S/C7H14O/c8-7-5-3-1-2-4-6-7/h7-8H,1-6H2\n"}] |
[{"from": "human", "value": "Write water solubility of given SMILES in 25 \u00b0C. -> Clc1cc(Cl)c(c(Cl)c1)c2c(Cl)cccc2Cl\n"}, {"from": "gpt", "value": " 4.78630092322638e-08 mol/L\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given compound in 25 \u00b0C? -> Triclosan\n"}, {"from": "gpt", "value": " -4.46\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [C][C][Branch1][C][C][C][=C]\n"}, {"from": "gpt", "value": " 3-Methyl-1-Butene\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> Pentylbenzene\n"}, {"from": "gpt", "value": " CCCCCc1ccccc1\n"}] |
[{"from": "human", "value": "What is water solubility of given SELFIES in 25 \u00b0C? -> [C][C][=C][C][=C][C][=C][Branch1][C][C][C][=C][C][=C][Ring1][O][Ring1][#Branch1]\n"}, {"from": "gpt", "value": " 2.0941124558508955e-05 mol/L\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][C][C][C][C][C][Branch1][S][C][C][C][=C][C][Branch1][C][O][=C][C][=C][Ring1][O][Ring1][#Branch1][C][Ring1][#C][C][C][C][Ring2][Ring1][C][=O]\n"}, {"from": "gpt", "value": " -3.955\n"}] |
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H\n"}, {"from": "gpt", "value": " Napthacene\n"}] |
[{"from": "human", "value": "What will be SMILES of given compound? -> Cortisone\n"}, {"from": "gpt", "value": " CC12CC(=O)C3C(CCC4=CC(=O)CCC34C)C2CCC1(O)C(=O)CO\n"}] |
[{"from": "human", "value": "Given SELFIES, write its compound. -> [C][C][C]\n"}, {"from": "gpt", "value": " Propane\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> Clc1cccc(n1)C(Cl)(Cl)Cl\n"}, {"from": "gpt", "value": " Nitrapyrin\n"}] |
[{"from": "human", "value": "Given SMILES, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> CCC(C)(O)CC\n"}, {"from": "gpt", "value": " -0.36\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> CC(C)C(O)C(C)C\n"}, {"from": "gpt", "value": " 2,4-Dimethyl-3-pentanol\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given SELFIES in room temperature? -> [O][C][=C][Branch1][C][Cl][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][=C][Ring1][=Branch2][Cl]\n"}, {"from": "gpt", "value": " -3.1\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> t-Butylbenzene \n"}, {"from": "gpt", "value": " CC(C)(C)c1ccccc1\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given InChI in room temperature? -> InChI=1S/C15H12O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-5,13,16-19H,6H2\n"}, {"from": "gpt", "value": " -3.62\n"}] |
[{"from": "human", "value": "Write water solubility of given SELFIES in room temperature. -> [C][C][Branch1][C][C][C][C][O][C][=Branch1][C][=O][C]\n"}, {"from": "gpt", "value": " 0.012022644346174132 mol/L\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given SMILES in room temperature. -> CCN(CC(C)=C)c1c(cc(cc1N(=O)=O)C(F)(F)F)N(=O)=O\n"}, {"from": "gpt", "value": " -6.124\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> ClCCBr\n"}, {"from": "gpt", "value": " 1-Chloro-2-bromoethane\n"}] |
[{"from": "human", "value": "What is compound of given InChI? -> InChI=1S/C5H11Cl/c1-4-5(2,3)6/h4H2,1-3H3\n"}, {"from": "gpt", "value": " 2-Chloro-2-methylbutane\n"}] |
[{"from": "human", "value": "What is aqueous solubility of given SMILES in room temperature? -> CC1CO1\n"}, {"from": "gpt", "value": " 0.2570395782768864 mol/L\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given SMILES in 25 \u00b0C. -> CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC\n"}, {"from": "gpt", "value": " -6.96\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 2-Phenoxyethanol\n"}, {"from": "gpt", "value": " [O][C][C][O][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [Br][C][=C][C][=C][Branch1][C][I][C][=C][Ring1][#Branch1]\n"}, {"from": "gpt", "value": " p-Bromoiodobenzene\n"}] |
[{"from": "human", "value": "Given SMILES, write its water solubility in 25 \u00b0C. -> Cc1ccccc1N\n"}, {"from": "gpt", "value": " 0.006165950018614822 mol/L\n"}] |
[{"from": "human", "value": "Write water solubility of given SMILES in room temperature. -> Oc1ccc(Cl)cc1Cl\n"}, {"from": "gpt", "value": " 0.028183829312644536 mol/L\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [C][C][C][O][C][Branch1][C][C][C]\n"}, {"from": "gpt", "value": " -1.34\n"}] |
[{"from": "human", "value": "What will be SMILES of given compound? -> Cholanthrene\n"}, {"from": "gpt", "value": " C1Cc2c3c1cccc3cc4c2ccc5ccccc54\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Ethanol\n"}, {"from": "gpt", "value": " [C][C][O]\n"}] |
[{"from": "human", "value": "Write aqueous solubility expressed as a logarithm in mol/L of given InChI in room temperature. -> InChI=1S/C20H42/c1-3-5-7-9-11-13-15-17-19-20-18-16-14-12-10-8-6-4-2/h3-20H2,1-2H3\n"}, {"from": "gpt", "value": " -8.172\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> Clc1ccc(Cl)c(c1)c2ccc(Cl)c(Cl)c2\n"}, {"from": "gpt", "value": " 2,3',4',5-PCB\n"}] |
[{"from": "human", "value": "Given compound, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> Glyceryl triacetate\n"}, {"from": "gpt", "value": " -0.6\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> o-Nitrophenol\n"}, {"from": "gpt", "value": " Oc1ccccc1N(=O)=O\n"}] |
[{"from": "human", "value": "Given compound, write its potential SMILES. -> 2,2-Dimethyl-1-butanol\n"}, {"from": "gpt", "value": " CCC(C)(C)CO\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility in 25 \u00b0C. -> [O][C][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][Branch1][N][C][=C][C][=C][Branch1][C][Cl][C][=C][Ring1][#Branch1][C][Branch1][C][Cl][Branch1][C][Cl][Cl]\n"}, {"from": "gpt", "value": " 2.1577444091526647e-06 mol/L\n"}] |
[{"from": "human", "value": "What is compound of given SMILES? -> c1(OC)ccc(CC=C)cc1\n"}, {"from": "gpt", "value": " Estragole\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> 1-Octadecanol\n"}, {"from": "gpt", "value": " [C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][C][O]\n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [Cl][C][Branch1][C][Br][Br]\n"}, {"from": "gpt", "value": " Chlorodibromethane\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> CC(=O)Nc1ccc(F)cc1\n"}, {"from": "gpt", "value": " p-Fluoroacetanilide\n"}] |
[{"from": "human", "value": "Write aqueous solubility of given InChI in 25 \u00b0C. -> InChI=1S/C6H12/c1-3-5-6-4-2/h3H,1,4-6H2,2H3\n"}, {"from": "gpt", "value": " 0.0005888436553555889 mol/L\n"}] |
[{"from": "human", "value": "Given SMILES, write its water solubility in room temperature. -> CCCCC(C)(O)CC\n"}, {"from": "gpt", "value": " 0.025118864315095794 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its water solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> InChI=1S/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3\n"}, {"from": "gpt", "value": " -1.96\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility in room temperature. -> InChI=1S/C21H27FO6/c1-18-6-5-12(24)7-11(18)3-4-13-14-8-15(25)21(28,17(27)10-23)19(14,2)9-16(26)20(13,18)22/h5-7,13-16,23,25-26,28H,3-4,8-10H2,1-2H3\n"}, {"from": "gpt", "value": " 0.00020892961308540387 mol/L\n"}] |
[{"from": "human", "value": "What is aqueous solubility of given compound in 25 \u00b0C? -> Trifluralin\n"}, {"from": "gpt", "value": " 2.0892961308540407e-06 mol/L\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Azodrin\n"}, {"from": "gpt", "value": " [C][N][C][=Branch1][C][=O][C][=C][Branch1][C][C][O][P][=Branch1][C][=O][Branch1][Ring1][O][C][O][C]\n"}] |
[{"from": "human", "value": "Given compound, write its aqueous solubility in 25 \u00b0C. -> Piperine\n"}, {"from": "gpt", "value": " 0.0003467368504525317 mol/L\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> [O][=C][N][C][=Branch1][C][=O][N][C][=Branch1][C][=O][C][Ring1][Branch2][Branch1][C][C][C][C]\n"}, {"from": "gpt", "value": " -1.228\n"}] |
[{"from": "human", "value": "Given SMILES, write its compound. -> CCN(CC)c1ccccc1\n"}, {"from": "gpt", "value": " N,N-Diethylaniline\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> Nc2cnn(c1ccccc1)c(=O)c2Cl\n"}, {"from": "gpt", "value": " Pyrazon\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Santonin\n"}, {"from": "gpt", "value": " [C][C][C][C][C][C][Branch1][C][C][C][=C][C][=Branch1][C][=O][C][=Branch1][N][=C][Ring1][Branch2][C][Ring1][N][O][C][Ring1][#C][=O][C]\n"}] |
[{"from": "human", "value": "Given compound, write its water solubility in 25 \u00b0C. -> 2,3,6-Trichlorophenol\n"}, {"from": "gpt", "value": " 0.0022908676527677724 mol/L\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> CC(C)C(C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1)c3ccc(OC(F)F)cc3\n"}, {"from": "gpt", "value": " Flucythrinate\n"}] |
[{"from": "human", "value": "What is water solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C? -> InChI=1S/C12H24O2/c1-3-5-6-7-8-9-10-11-12(13)14-4-2/h3-11H2,1-2H3\n"}, {"from": "gpt", "value": " -4.1\n"}] |
[{"from": "human", "value": "What is compound of given SELFIES? -> [Cl][C][C][C][Cl]\n"}, {"from": "gpt", "value": " 1,3-Dichloropropane\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given InChI in 25 \u00b0C? -> InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3\n"}, {"from": "gpt", "value": " -0.04\n"}] |
[{"from": "human", "value": "Write InChI of given compound. -> Etofenprox\n"}, {"from": "gpt", "value": " InChI=1S/C25H28O3/c1-4-27-22-15-13-21(14-16-22)25(2,3)19-26-18-20-9-8-12-24(17-20)28-23-10-6-5-7-11-23/h5-17H,4,18-19H2,1-3H3\n"}] |
[{"from": "human", "value": "What will be SELFIES of given compound? -> Di-n-propylsulfide\n"}, {"from": "gpt", "value": " [C][C][C][S][C][C][C]\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> Sorbitol\n"}, {"from": "gpt", "value": " OCC(O)C(O)C(O)C(O)CO\n"}] |
[{"from": "human", "value": "Write water solubility of given compound in 25 \u00b0C. -> Isopropyl formate\n"}, {"from": "gpt", "value": " 0.2344228815319922 mol/L\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H\n"}, {"from": "gpt", "value": " 1,2-Benzenediol\n"}] |
[{"from": "human", "value": "Write a possible SMILES of given compound. -> 3-Methyl-3-pentanol\n"}, {"from": "gpt", "value": " CCC(C)(O)CC\n"}] |
[{"from": "human", "value": "Given SELFIES, write its aqueous solubility expressed as a logarithm in mol/L in 25 \u00b0C. -> [O][=C][C][=C][C][=C][C][=C][Ring1][=Branch1]\n"}, {"from": "gpt", "value": " -1.19\n"}] |
[{"from": "human", "value": "Write compound of given SELFIES. -> [O][C][=C][Branch1][C][I][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][=Branch2][I]\n"}, {"from": "gpt", "value": " Ioxynil\n"}] |
[{"from": "human", "value": "Given InChI, write its aqueous solubility expressed as a logarithm in mol/L in room temperature. -> InChI=1S/C10H20O/c1-3-4-5-6-7-8-9-10(2)11/h3-9H2,1-2H3\n"}, {"from": "gpt", "value": " -3.3\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Niridazole\n"}, {"from": "gpt", "value": " [O][=C][N][C][C][N][Ring1][Branch1][C][=N][C][=C][Branch1][Ring2][S][Ring1][Branch1][N][=Branch1][C][=O][=O]\n"}] |
[{"from": "human", "value": "What is InChI of given compound? -> Clonazepam\n"}, {"from": "gpt", "value": " InChI=1S/C15H10ClN3O3/c16-12-4-2-1-3-10(12)15-11-7-9(19(21)22)5-6-13(11)18-14(20)8-17-15/h1-7H,8H2,(H,18,20)\n"}] |
[{"from": "human", "value": "What is water solubility of given InChI in room temperature? -> InChI=1S/C10H20N2S4/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3\n"}, {"from": "gpt", "value": " 1.3803842646028839e-05 mol/L\n"}] |
[{"from": "human", "value": "Write water solubility of given InChI in 25 \u00b0C. -> InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3\n"}, {"from": "gpt", "value": " 5.116818355403073e-07 mol/L\n"}] |
[{"from": "human", "value": "Write compound of given SMILES. -> c1c(NC(=O)OC(C)C(=O)NCC)cccc1\n"}, {"from": "gpt", "value": " Carbetamide\n"}] |
[{"from": "human", "value": "Write water solubility of given SELFIES in room temperature. -> [C][C][Branch1][C][C][I]\n"}, {"from": "gpt", "value": " 0.008128305161640995 mol/L\n"}] |
[{"from": "human", "value": "Write compound of given InChI. -> InChI=1S/C12H15N2O3PS/c1-3-15-18(19,16-4-2)17-14-12(10-13)11-8-6-5-7-9-11/h5-9H,3-4H2,1-2H3\n"}, {"from": "gpt", "value": " Phoxim\n"}] |
[{"from": "human", "value": "Given compound, write its aqueous solubility in room temperature. -> 3,3-Dimethyl-2-butanone\n"}, {"from": "gpt", "value": " 0.19054607179632474 mol/L\n"}] |
[{"from": "human", "value": "What is water solubility of given compound in 25 \u00b0C? -> ampyrone\n"}, {"from": "gpt", "value": " 0.23768402866248767 mol/L\n"}] |
[{"from": "human", "value": "Given compound, write its potential SELFIES. -> Deoxycorticosterone\n"}, {"from": "gpt", "value": " [C][C][C][C][C][C][Branch1][P][C][C][C][=C][C][=Branch1][C][=O][C][C][C][Ring1][O][Ring1][#Branch1][C][C][Ring1][S][C][C][C][Ring2][Ring1][Ring1][C][=Branch1][C][=O][C][O]\n"}] |
[{"from": "human", "value": "Given InChI, write its compound. -> InChI=1S/CH6N2/c1-3-2/h3H,2H2,1H3\n"}, {"from": "gpt", "value": " Methyl hydrazine\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given compound in room temperature? -> 3-Heptanol \n"}, {"from": "gpt", "value": " -1.47\n"}] |
[{"from": "human", "value": "What is aqueous solubility expressed as a logarithm in mol/L of given compound in room temperature? -> 1-Octene \n"}, {"from": "gpt", "value": " -4.44\n"}] |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.